3
0
mirror of https://github.com/triqs/dft_tools synced 2025-04-25 17:54:54 +02:00

Corrections for new calc_dc and calc_mu

* typos and subbed check in spin polarized calculations for quantum espresso with a warning when computing the deltaN
* fixed typos in comments
* removed legacy mode maintaining only compatibility layer and switched to old (<3.10) python syntax
* added target density output in mu finder for brent and newton, refactored tunit test for DC, changed some comments
This commit is contained in:
alberto-carta 2023-02-13 12:41:17 +01:00 committed by Alexander Hampel
parent d4f3c48784
commit 0d25aefc73
7 changed files with 265 additions and 138 deletions

1
.gitignore vendored
View File

@ -1,3 +1,2 @@
compile_commands.json compile_commands.json
doc/cpp2rst_generated doc/cpp2rst_generated
build/

View File

@ -38,10 +38,11 @@ from warnings import warn
from scipy import compress from scipy import compress
from scipy.optimize import minimize, newton, brenth from scipy.optimize import minimize, newton, brenth
def compute_DC_from_density(N_tot, U, J, N_spin = None, n_orbitals=5, method='cFLL'): def compute_DC_from_density(N_tot, U, J, N_spin = None, n_orbitals=5, method='sFLL'):
""" """
Computes the double counting correction in terms using various methods Computes the double counting correction using various methods.
For FLL and AMF DC the notations and equations from doi.org/10.1038/s41598-018-27731-4
are used, whereas for the Held DC the definitions from doi.org/10.1080/00018730701619647 are used.
Parameters Parameters
---------- ----------
@ -69,45 +70,48 @@ def compute_DC_from_density(N_tot, U, J, N_spin = None, n_orbitals=5, method='
List of floats: List of floats:
- DC_val: double counting potential - DC_val: double counting potential
- E_val: double counting energy - E_val: double counting energy
todo: See whether to move this to TRIQS directly instead of dft_tools
""" """
if N_spin is not None: if N_spin is not None:
N_spin2 = N_tot-N_spin N_spin2 = N_tot-N_spin
Mag = N_spin - N_spin2 Mag = N_spin - N_spin2
L_orbit = (n_orbitals-1)/2 L_orbit = (n_orbitals-1)/2
match method: if method == 'cFLL':
case 'cFLL': E_val = 0.5 * U * N_tot * (N_tot-1) - 0.5 * J * N_tot * (N_tot*0.5-1)
E_val = 0.5 * U * N_tot * (N_tot-1) - 0.5 * J * N_tot * (N_tot*0.5-1) DC_val = U * (N_tot-0.5) - J *(N_tot*0.5-0.5)
DC_val = U * (N_tot-0.5) - J *(N_tot*0.5-0.5)
case 'sFLL': elif method == 'sFLL':
assert N_spin is not None, "Spin density not given" assert N_spin is not None, "Spin density not given"
E_val = 0.5 * U * N_tot * (N_tot-1) - 0.5 * J * N_tot * (N_tot*0.5-1) - 0.25 * J * Mag**2 E_val = 0.5 * U * N_tot * (N_tot-1) - 0.5 * J * N_tot * (N_tot*0.5-1) - 0.25 * J * Mag**2
DC_val = U * (N_tot-0.5) - J *(N_spin-0.5) DC_val = U * (N_tot-0.5) - J *(N_spin-0.5)
case 'cAMF': elif method == 'cAMF':
E_val = +0.5 * U * N_tot **2 E_val = +0.5 * U * N_tot **2
E_val -= 0.25*(U+2*L_orbit*J)/(2*L_orbit+1)*N_tot**2 E_val -= 0.25*(U+2*L_orbit*J)/(2*L_orbit+1)*N_tot**2
DC_val = U * N_tot - 0.5*(U+2*L_orbit*J)/(2*L_orbit+1)*N_tot DC_val = U * N_tot - 0.5*(U+2*L_orbit*J)/(2*L_orbit+1)*N_tot
case 'sAMF': elif method == 'sAMF':
assert N_spin is not None, "Spin density not given" assert N_spin is not None, "Spin density not given"
E_val = 0.5 * U * N_tot **2 E_val = 0.5 * U * N_tot **2
E_val -= 0.25*(U+2*L_orbit*J)/(2*L_orbit+1)*N_tot**2 E_val -= 0.25*(U+2*L_orbit*J)/(2*L_orbit+1)*N_tot**2
E_val -= 0.25*(U+2*L_orbit*J)/(2*L_orbit+1)*Mag**2 E_val -= 0.25*(U+2*L_orbit*J)/(2*L_orbit+1)*Mag**2
DC_val = U * N_tot - (U+2*L_orbit*J)/(2*L_orbit+1)*N_spin DC_val = U * N_tot - (U+2*L_orbit*J)/(2*L_orbit+1)*N_spin
case 'cHeld': elif method == 'cHeld':
U_mean = (U + (n_orbitals-1)*(U-2*J)+(n_orbitals-1)*(U-3*J))/(2*n_orbitals-1) # Valid for a Kanamori-type Hamiltonian where U'=U-2J
E_val = 0.5 * U_mean * N_tot * (N_tot - 1) U_mean = (U + (n_orbitals-1)*(U-2*J)+(n_orbitals-1)*(U-3*J))/(2*n_orbitals-1)
DC_val = U_mean * (N_tot-0.5) E_val = 0.5 * U_mean * N_tot * (N_tot - 1)
DC_val = U_mean * (N_tot-0.5)
case 'sHeld': elif method == 'sHeld':
raise ValueError(f"Method sHeld not yet implemented") raise ValueError(f"Method sHeld not yet implemented")
case _: else:
raise ValueError(f"DC type {method} not supported") raise ValueError(f"DC type {method} not supported")
mpi.report(f"DC potential computed using the {method} method, V_DC = {DC_val:.6f} eV") mpi.report(f"DC potential computed using the {method} method, V_DC = {DC_val:.6f} eV")
mpi.report(f"E_DC using the {method} method, E_DC = {E_val:.6f} eV") mpi.report(f"E_DC using the {method} method, E_DC = {E_val:.6f} eV")
@ -1735,7 +1739,7 @@ class SumkDFT(object):
self.dc_energ = dc_energ self.dc_energ = dc_energ
def calc_dc(self, dens_mat, orb=0, U_interact=None, J_hund=None, def calc_dc(self, dens_mat, orb=0, U_interact=None, J_hund=None,
use_dc_formula=0, use_dc_value=None, transform=True, legacy=True): use_dc_formula=0, use_dc_value=None, transform=True):
r""" r"""
Calculate and set the double counting corrections. Calculate and set the double counting corrections.
@ -1767,8 +1771,13 @@ class SumkDFT(object):
Value of interaction parameter `U`. Value of interaction parameter `U`.
J_hund : float, optional J_hund : float, optional
Value of interaction parameter `J`. Value of interaction parameter `J`.
use_dc_formula : int, optional use_dc_formula : int or string, optional
Type of double-counting correction (see description). Type of double-counting correction (see description of `compute_DC_from_density` above).
There is an interface with the legacy implementation which allows for the old convention:
* 0 -> 'sFLL' spin dependent fully localized limit
* 1 -> 'cHeld' spin independent Held formula
* 2 -> 'sAMF' spin dependent around-mean field approximation
use_dc_value : float, optional use_dc_value : float, optional
Value of the double-counting correction. If specified Value of the double-counting correction. If specified
`U_interact`, `J_hund` and `use_dc_formula` are ignored. `U_interact`, `J_hund` and `use_dc_formula` are ignored.
@ -1807,68 +1816,21 @@ class SumkDFT(object):
dim //= 2 dim //= 2
if use_dc_value is None: if use_dc_value is None:
if legacy: #For legacy compatibility
if use_dc_formula == 0:
if U_interact is None and J_hund is None: mpi.report(f"Detected {use_dc_formula=}, changing to sFLL")
raise ValueError("set_dc: either provide U_interact and J_hund or set use_dc_value to dc value.") use_dc_formula = "sFLL"
if use_dc_formula == 1:
if use_dc_formula == 0: # FLL mpi.report(f"Detected {use_dc_formula=}, changing to cHeld")
use_dc_formula = "cHeld"
self.dc_energ[icrsh] = U_interact / \ if use_dc_formula == 2:
2.0 * Ncrtot * (Ncrtot - 1.0) mpi.report(f"Detected {use_dc_formula=}, changing to sAMF")
for sp in spn: use_dc_formula = "sAMF"
Uav = U_interact * (Ncrtot - 0.5) - \
J_hund * (Ncr[sp] - 0.5)
self.dc_imp[icrsh][sp] *= Uav
self.dc_energ[icrsh] -= J_hund / \
len(spn) * (Ncr[sp]) * (Ncr[sp] - 1.0)
mpi.report(
"DC for shell %(icrsh)i and block %(sp)s = %(Uav)f" % locals())
elif use_dc_formula == 1: # Held's formula, with U_interact the interorbital onsite interaction
self.dc_energ[icrsh] = (U_interact + (dim - 1) * (U_interact - 2.0 * J_hund) + (
dim - 1) * (U_interact - 3.0 * J_hund)) / (2 * dim - 1) / 2.0 * Ncrtot * (Ncrtot - 1.0)
for sp in spn:
Uav = (U_interact + (dim - 1) * (U_interact - 2.0 * J_hund) + (dim - 1)
* (U_interact - 3.0 * J_hund)) / (2 * dim - 1) * (Ncrtot - 0.5)
self.dc_imp[icrsh][sp] *= Uav
mpi.report(
"DC for shell %(icrsh)i and block %(sp)s = %(Uav)f" % locals())
elif use_dc_formula == 2: # AMF
self.dc_energ[icrsh] = 0.5 * U_interact * Ncrtot * Ncrtot
for sp in spn:
Uav = U_interact * \
(Ncrtot - Ncr[sp] / dim) - \
J_hund * (Ncr[sp] - Ncr[sp] / dim)
self.dc_imp[icrsh][sp] *= Uav
self.dc_energ[
icrsh] -= (U_interact + (dim - 1) * J_hund) / dim / len(spn) * Ncr[sp] * Ncr[sp]
mpi.report(
"DC for shell %(icrsh)i and block %(sp)s = %(Uav)f" % locals())
mpi.report("DC energy for shell %s = %s" %
(icrsh, self.dc_energ[icrsh]))
else: for sp in spn:
#For legacy compatibility DC_val, E_val = compute_DC_from_density(N_tot=Ncrtot,U=U_interact, J=J_hund, n_orbitals=dim, N_spin=Ncr[sp], method=use_dc_formula)
match use_dc_formula: self.dc_imp[icrsh][sp] *= DC_val
case 0: self.dc_energ[icrsh] = E_val
mpi.report(f"Detected {use_dc_formula=}, changing to sFLL")
use_dc_formula = "sFLL"
case 1:
mpi.report(f"Detected {use_dc_formula=}, changing to cHeld")
use_dc_formula = "cHeld"
case 2:
mpi.report(f"Detected {use_dc_formula=}, changing to sAMF")
use_dc_formula = "sAMF"
for sp in spn:
DC_val, E_val = compute_DC_from_density(N_tot=Ncrtot,U=U_interact, J=J_hund, n_orbitals=dim, N_spin=Ncr[sp], method=use_dc_formula)
self.dc_imp[icrsh][sp] *= DC_val
self.dc_energ[icrsh] -= E_val
@ -2048,7 +2010,6 @@ class SumkDFT(object):
def calc_mu(self, precision=0.01, broadening=None, delta=0.5, max_loops=100, method="dichotomy"): def calc_mu(self, precision=0.01, broadening=None, delta=0.5, max_loops=100, method="dichotomy"):
r""" r"""
Searches for the chemical potential that gives the DFT total charge. Searches for the chemical potential that gives the DFT total charge.
A simple bisection method is used.
Parameters Parameters
---------- ----------
@ -2061,7 +2022,7 @@ class SumkDFT(object):
max_loops : int, optional max_loops : int, optional
Number of dichotomy loops maximally performed. Number of dichotomy loops maximally performed.
max_loops : string, optional method : string, optional
Type of optimization used: Type of optimization used:
* dichotomy: usual bisection algorithm from the TRIQS library * dichotomy: usual bisection algorithm from the TRIQS library
* newton: newton method, faster convergence but more unstable * newton: newton method, faster convergence but more unstable
@ -2116,52 +2077,50 @@ class SumkDFT(object):
mpi.report("Trying out mu = {}".format(str(mu))) mpi.report("Trying out mu = {}".format(str(mu)))
calc_dens = self.total_density(mu=mu, broadening=broadening).real - density calc_dens = self.total_density(mu=mu, broadening=broadening).real - density
mpi.report("Delta to target density = {}".format(str(calc_dens))) mpi.report(f"Target density = {density}; Delta to target = {calc_dens}")
return calc_dens return calc_dens
#check for lowercase matching for the method variable #check for lowercase matching for the method variable
match method.lower(): if method.lower()=="dichotomy":
mpi.report("\nSUMK calc_mu: Using dichtomy adjustment to find chemical potential\n")
self.chemical_potential = dichotomy.dichotomy(function=F_bisection,
x_init=self.chemical_potential, y_value=density,
precision_on_y=precision, delta_x=delta, max_loops=max_loops,
x_name="Chemical Potential", y_name="Total Density",
verbosity=3)[0]
elif method.lower()=="newton":
mpi.report("\nSUMK calc_mu: Using Newton method to find chemical potential\n")
self.chemical_potential = newton(func=F_optimize,
x0=self.chemical_potential,
tol=precision, maxiter=max_loops,
)
case "dichotomy": elif method.lower()=="brent":
mpi.report("\nSUMK calc_mu: Using dichtomy adjustment to find chemical potential\n") mpi.report("\nSUMK calc_mu: Using Brent method to find chemical potential")
self.chemical_potential = dichotomy.dichotomy(function=F_bisection, mpi.report("SUMK calc_mu: Finding bounds \n")
x_init=self.chemical_potential, y_value=density,
precision_on_y=precision, delta_x=delta, max_loops=max_loops,
x_name="Chemical Potential", y_name="Total Density",
verbosity=3)[0]
case 'newton':
mpi.report("\nSUMK calc_mu: Using Newton method to find chemical potential\n")
self.chemical_potential = newton(func=F_optimize,
x0=self.chemical_potential,
tol=precision, maxiter=max_loops,
)
case 'brent':
mpi.report("\nSUMK calc_mu: Using Brent method to find chemical potential")
mpi.report("SUMK calc_mu: Finding bounds \n")
mu_guess_0, mu_guess_1 = find_bounds(function=F_optimize,
x_init=self.chemical_potential,
delta_x=delta, max_loops=max_loops,
)
mu_guess_1 += 0.01 #scrambles higher lying interval to avoid getting stuck
mpi.report("\nSUMK calc_mu: Searching root with Brent method\n")
self.chemical_potential = brenth(f=F_optimize,
a=mu_guess_0,
b=mu_guess_1,
xtol=precision, maxiter=max_loops,
)
case _: mu_guess_0, mu_guess_1 = find_bounds(function=F_optimize,
raise ValueError( x_init=self.chemical_potential,
f"SUMK calc_mu: The method selected: {method}, is not implemented\n", delta_x=delta, max_loops=max_loops,
""" )
Please check for typos or select one of the following: mu_guess_1 += 0.01 #scrambles higher lying interval to avoid getting stuck
* dichotomy: usual bisection algorithm from the TRIQS library mpi.report("\nSUMK calc_mu: Searching root with Brent method\n")
* newton: newton method, fastest convergence but more unstable self.chemical_potential = brenth(f=F_optimize,
* brent: finds bounds and proceeds with hyperbolic brent method, a compromise between speed and ensuring convergence a=mu_guess_0,
""" b=mu_guess_1,
) xtol=precision, maxiter=max_loops,
)
else:
raise ValueError(
f"SUMK calc_mu: The selected method: {method}, is not implemented\n",
"""
Please check for typos or select one of the following:
* dichotomy: usual bisection algorithm from the TRIQS library
* newton: newton method, fastest convergence but more unstable
* brent: finds bounds and proceeds with hyperbolic brent method, a compromise between speed and ensuring convergence
"""
)
return self.chemical_potential return self.chemical_potential
@ -2414,7 +2373,8 @@ class SumkDFT(object):
f.write("\n") f.write("\n")
elif dm_type == 'qe': elif dm_type == 'qe':
assert self.SP == 0, "Spin-polarized density matrix is not implemented" if self.SP == 0:
mpi.report("SUMK calc_density_correction: WARNING! Averaging out spin-polarized correction in the density channel")
subgrp = 'dft_update' subgrp = 'dft_update'
delta_N = np.zeros([self.n_k, max(self.n_orbitals[:,0]), max(self.n_orbitals[:,0])], dtype=complex) delta_N = np.zeros([self.n_k, max(self.n_orbitals[:,0]), max(self.n_orbitals[:,0])], dtype=complex)

BIN
test/python/NiO.ref.h5 Executable file

Binary file not shown.

BIN
test/python/NiO.ref.h5_copy Executable file

Binary file not shown.

Binary file not shown.

Binary file not shown.

168
test/python/dc_test.py Executable file
View File

@ -0,0 +1,168 @@
##########################################################################
#
# TRIQS: a Toolbox for Research in Interacting Quantum Systems
#
# Copyright (C) 2023 by A. Carta
#
# TRIQS is free software: you can redistribute it and/or modify it under the
# terms of the GNU General Public License as published by the Free Software
# Foundation, either version 3 of the License, or (at your option) any later
# version.
#
# TRIQS is distributed in the hope that it will be useful, but WITHOUT ANY
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
# details.
#
# You should have received a copy of the GNU General Public License along with
# TRIQS. If not, see <http://www.gnu.org/licenses/>.
#
##########################################################################
import numpy as np
from triqs_dft_tools.sumk_dft import *
from triqs.gf import *
from h5 import HDFArchive
from triqs.operators.util import *
import triqs.utility.mpi as mpi
Uval = 5
Jval = 0.3
method_dict = {
"FLL":{
"numbering_convention":0,
"new_convention":"cFLL"
},
"AMF":{
"numbering_convention":2,
"new_convention":"cAMF"
},
"Held":{
"numbering_convention":1,
"new_convention":"cHeld"
},
}
def test_dc(method, method_dict, dens, Uval, Jval, filename):
dc_no = method_dict[method]["numbering_convention"]
dc_string = method_dict[method]["new_convention"]
mpi.report("XXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXX")
mpi.report(f"\n Testing interface {method} \n")
mpi.report("XXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXXX")
mpi.report("\nTesting legacy compatibility layer:\n")
SK_compat.calc_dc(dens_mat=dens[0], U_interact=Uval, J_hund=Jval, use_dc_formula=dc_no )
mpi.report("Up DC matrix:")
mpi.report(SK_compat.dc_imp[0]['up'])
mpi.report(f"Double counting energy = {SK_compat.dc_energ} ")
mpi.report("\nTesting new dc interface:\n")
SK_new.calc_dc(dens_mat=dens[0], U_interact=Uval, J_hund=Jval, use_dc_formula=dc_string)
mpi.report("Up DC matrix:")
mpi.report(SK_new.dc_imp[0]['up'])
mpi.report(f"Double counting energy = {SK_new.dc_energ} ")
# Load previously computed DC values from h5 archive
R = HDFArchive(f'./{filename}', 'r')
dc_comp = R[f'DC_{method}_benchmark']['dc_imp']
en_comp = R[f'DC_{method}_benchmark']['dc_energ']
del R
mpi.report(f"\nAsserting comparison for method: {method}")
assert np.allclose(SK_compat.dc_imp[0]['up'], dc_comp, atol=1e-12), f"Assertion failed comparing legacy Vdc to reference, method: {method} "
assert np.allclose(SK_compat.dc_energ, en_comp, atol=1e-12), f"Assertion failed comparing legacy energy to reference, method {method} "
assert np.allclose(SK_new.dc_imp[0]['up'], dc_comp, atol=1e-12), f"Assertion failed comparing Vdc to reference, method: {method} "
assert np.allclose(SK_new.dc_energ, en_comp, atol=1e-12), f"Assertion failed comparing energy to reference, method: {method} "
mpi.report("Comparison with stored DC values successfull!\n")
# %% 5 orbitals testing
mpi.report("\n############################################")
mpi.report("############################################")
mpi.report(f"\n \n Starting tests for 5 orbitals \n \n")
mpi.report("############################################")
mpi.report("############################################")
dft_filename = "./NiO.ref"
use_blocks = False
SK_compat = SumkDFT(hdf_file=dft_filename+'.h5',use_dft_blocks=use_blocks)
SK_compat.set_mu(13.9)
SK_new = SumkDFT(hdf_file=dft_filename+'.h5',use_dft_blocks=use_blocks)
SK_new.set_mu(13.9)
icrsh = 0
dens = SK_compat.density_matrix()
with np.printoptions(precision=5):
for key in dens[0].keys():
mpi.report(f"{key} channel")
mpi.report(dens[0][key].real)
N_up = np.trace(dens[0]['up'].real)
N_down = np.trace(dens[0]['down'].real)
N_tot = N_up + N_down
mpi.report(f"{N_up=} ,{N_down=}, {N_tot=}\n")
for method in ["FLL", "AMF", "Held"]:
test_dc(method, method_dict, dens, Uval, Jval, filename = f"{dft_filename}.h5")
#in case implementation changes, to write new testing data into archive
#R = HDFArchive('./NiO.ref.h5', 'a')
#R.create_group(f'DC_{method}_benchmark')
#R[f'DC_{method}_benchmark']['dc_imp']= SK_new.dc_imp[0]['up']
#R[f'DC_{method}_benchmark']['dc_energ']= SK_new.dc_energ
#del R
# 3 orbital testing
mpi.report("############################################")
mpi.report("############################################")
mpi.report(f"\n \n Starting tests for 3 orbitals \n \n")
mpi.report("############################################")
mpi.report("############################################")
dft_filename = "./SrVO3.ref"
use_blocks = False
SK_compat = SumkDFT(hdf_file=dft_filename+'.h5',use_dft_blocks=use_blocks)
SK_new = SumkDFT(hdf_file=dft_filename+'.h5',use_dft_blocks=use_blocks)
icrsh = 0
dens = SK_compat.density_matrix()
with np.printoptions(precision=5):
for key in dens[0].keys():
mpi.report(f"{key} channel")
mpi.report(dens[0][key].real)
N_up = np.trace(dens[0]['up'].real)
N_down = np.trace(dens[0]['down'].real)
N_tot = N_up + N_down
mpi.report(f"{N_up=} ,{N_down=}, {N_tot=}\n")
Uval = 5
Jval = 0.3
for method in ["FLL", "AMF", "Held"]:
test_dc(method, method_dict, dens, Uval, Jval, filename = f"{dft_filename}.h5" )
#in case implementation changes, to write new testing data into archive
#R = HDFArchive(f'./{dft_filename}.h5', 'a')
#R.create_group(f'DC_{method}_benchmark')
#R[f'DC_{method}_benchmark']['dc_imp']= SK_new.dc_imp[0]['up']
#R[f'DC_{method}_benchmark']['dc_energ']= SK_new.dc_energ
#del R